C24H29NO3S — CID 57401256
N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide (PubChem CID 57401256) has the molecular formula C24H29NO3S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide.
| Compound Name | N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57401256 |
| Molecular Formula | C24H29NO3S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H29NO3S/c1-24-14-13-20-19-10-8-17(26)15-16(19)7-9-21(20)22(24)11-12-23(24)25-29(27,28)18-5-3-2-4-6-18/h2-6,8,10,15,20-23,25-26H,7,9,11-14H2,1H3/t20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | LZLZNWVEPICRAJ-DJCPXJLLSA-N |
| XLogP | 4.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |