C28H37NO3S — CID 57325495
4-tert-butyl-N-[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide (PubChem CID 57325495) has the molecular formula C28H37NO3S and a molecular weight of 467.68 g/mol. Its IUPAC name is 4-tert-butyl-N-[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57325495 |
| Molecular Formula | C28H37NO3S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 4-tert-butyl-N-[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N[C@H]2CCC3C4CCc5cc(O)ccc5C4CC[C@@]32C)cc1 |
| InChI | InChI=1S/C28H37NO3S/c1-27(2,3)19-6-9-21(10-7-19)33(31,32)29-26-14-13-25-24-11-5-18-17-20(30)8-12-22(18)23(24)15-16-28(25,26)4/h6-10,12,17,23-26,29-30H,5,11,13-16H2,1-4H3/t23?,24?,25?,26-,28-/m0/s1 |
| InChIKey | PRMOTXDSPZGYAI-ASQPPMIUSA-N |
| XLogP | 5.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |