C25H30ClNO3S — CID 155805225
1-(4-chlorophenyl)-N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methanesulfonamide (PubChem CID 155805225) has the molecular formula C25H30ClNO3S and a molecular weight of 460.04 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methanesulfonamide |
|---|---|
| PubChem CID | 155805225 |
| Molecular Formula | C25H30ClNO3S |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methanesulfonamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2NS(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClNO3S/c1-25-13-12-21-20-9-7-19(28)14-17(20)4-8-22(21)23(25)10-11-24(25)27-31(29,30)15-16-2-5-18(26)6-3-16/h2-3,5-7,9,14,21-24,27-28H,4,8,10-13,15H2,1H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | JBFUSIJSXAEMBJ-VAFBSOEGSA-N |
| XLogP | 5.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |