C21H28N2O5S — CID 87881529
[(13S)-17-[methoxy(methyl)carbamoyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 87881529) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is [(13S)-17-[methoxy(methyl)carbamoyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(13S)-17-[methoxy(methyl)carbamoyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 87881529 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(13S)-17-[methoxy(methyl)carbamoyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | CON(C)C(=O)C1=CCC2C3CCc4cc(NS(=O)(=O)O)ccc4C3CC[C@]12C |
| InChI | InChI=1S/C21H28N2O5S/c1-21-11-10-16-15-7-5-14(22-29(25,26)27)12-13(15)4-6-17(16)18(21)8-9-19(21)20(24)23(2)28-3/h5,7,9,12,16-18,22H,4,6,8,10-11H2,1-3H3,(H,25,26,27)/t16?,17?,18?,21-/m0/s1 |
| InChIKey | ZYJSYDSPAWYBTP-XPGIBRRYSA-N |
| XLogP | 3.31 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|