C29H35NO2 — CID 12019233
(8S,9S,13S,14S)-13-methyl-3-phenylmethoxy-N-propyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 12019233) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is (8S,9S,13S,14S)-13-methyl-3-phenylmethoxy-N-propyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8S,9S,13S,14S)-13-methyl-3-phenylmethoxy-N-propyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 12019233 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (8S,9S,13S,14S)-13-methyl-3-phenylmethoxy-N-propyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CCCNC(=O)C1=CC[C@H]2[C@@H]3CCc4cc(OCc5ccccc5)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H35NO2/c1-3-17-30-28(31)27-14-13-26-25-11-9-21-18-22(32-19-20-7-5-4-6-8-20)10-12-23(21)24(25)15-16-29(26,27)2/h4-8,10,12,14,18,24-26H,3,9,11,13,15-17,19H2,1-2H3,(H,30,31)/t24-,25-,26+,29+/m1/s1 |
| InChIKey | CIYFMKNWYPEAIR-JMDODURXSA-N |
| XLogP | 6.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |