C29H34O — CID 102575568
(8S,9S,13S,14S)-17-[(2R)-but-3-en-2-yl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene (PubChem CID 102575568) has the molecular formula C29H34O and a molecular weight of 398.59 g/mol. Its IUPAC name is (8S,9S,13S,14S)-17-[(2R)-but-3-en-2-yl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13S,14S)-17-[(2R)-but-3-en-2-yl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 102575568 |
| Molecular Formula | C29H34O |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (8S,9S,13S,14S)-17-[(2R)-but-3-en-2-yl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
| SMILES | C=C[C@@H](C)C1=CC[C@H]2[C@@H]3CCc4cc(OCc5ccccc5)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H34O/c1-4-20(2)27-14-15-28-26-12-10-22-18-23(30-19-21-8-6-5-7-9-21)11-13-24(22)25(26)16-17-29(27,28)3/h4-9,11,13-14,18,20,25-26,28H,1,10,12,15-17,19H2,2-3H3/t20-,25-,26-,28+,29-/m1/s1 |
| InChIKey | LXAPWGBTUIUALS-KGXFQKJDSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|