C25H28O — CID 131700269
(8S,9R,13R,14R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene (PubChem CID 131700269) has the molecular formula C25H28O and a molecular weight of 344.50 g/mol. Its IUPAC name is (8S,9R,13R,14R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,13R,14R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 131700269 |
| Molecular Formula | C25H28O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (8S,9R,13R,14R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12C=CC[C@@H]1[C@@H]1CCc3cc(OCc4ccccc4)ccc3[C@@H]1CC2 |
| InChI | InChI=1S/C25H28O/c1-25-14-5-8-24(25)23-11-9-19-16-20(10-12-21(19)22(23)13-15-25)26-17-18-6-3-2-4-7-18/h2-7,10,12,14,16,22-24H,8-9,11,13,15,17H2,1H3/t22-,23+,24+,25-/m0/s1 |
| InChIKey | VAHVWDBSHRYVAP-LIONHTAISA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|