C28H33NO3 — CID 71524903
(8R,9S,13R,14S,16E)-13-methyl-3-phenylmethoxy-16-propoxyimino-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one (PubChem CID 71524903) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (8R,9S,13R,14S,16E)-13-methyl-3-phenylmethoxy-16-propoxyimino-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13R,14S,16E)-13-methyl-3-phenylmethoxy-16-propoxyimino-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 71524903 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (8R,9S,13R,14S,16E)-13-methyl-3-phenylmethoxy-16-propoxyimino-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CCCO/N=C1\C[C@H]2[C@@H]3CCc4cc(OCc5ccccc5)ccc4[C@H]3CC[C@@]2(C)C1=O |
| InChI | InChI=1S/C28H33NO3/c1-3-15-32-29-26-17-25-24-11-9-20-16-21(31-18-19-7-5-4-6-8-19)10-12-22(20)23(24)13-14-28(25,2)27(26)30/h4-8,10,12,16,23-25H,3,9,11,13-15,17-18H2,1-2H3/b29-26+/t23-,24-,25+,28-/m1/s1 |
| InChIKey | VCEXYGBGOQTATO-CMVGGTMRSA-N |
| XLogP | 6.08 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|