C33H34N2O6 — CID 71524995
(8R,9S,13S,14S,16E)-3-[(4-methoxyphenyl)methoxy]-13-methyl-16-[(4-nitrophenyl)methoxyimino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one (PubChem CID 71524995) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is (8R,9S,13S,14S,16E)-3-[(4-methoxyphenyl)methoxy]-13-methyl-16-[(4-nitrophenyl)methoxyimino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,16E)-3-[(4-methoxyphenyl)methoxy]-13-methyl-16-[(4-nitrophenyl)methoxyimino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 71524995 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | (8R,9S,13S,14S,16E)-3-[(4-methoxyphenyl)methoxy]-13-methyl-16-[(4-nitrophenyl)methoxyimino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc(COc2ccc3c(c2)CC[C@@H]2[C@@H]3CC[C@]3(C)C(=O)/C(=N/OCc4ccc([N+](=O)[O-])cc4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C33H34N2O6/c1-33-16-15-28-27-14-12-26(40-19-21-5-10-25(39-2)11-6-21)17-23(27)7-13-29(28)30(33)18-31(32(33)36)34-41-20-22-3-8-24(9-4-22)35(37)38/h3-6,8-12,14,17,28-30H,7,13,15-16,18-20H2,1-2H3/b34-31+/t28-,29-,30+,33+/m1/s1 |
| InChIKey | FSSANWZYCUHAJI-JZLAWMJYSA-N |
| XLogP | 6.79 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|