C33H37NO2 — CID 66624320
(8R,9S,13S,14R,15S)-15-[(benzylamino)methyl]-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 66624320) has the molecular formula C33H37NO2 and a molecular weight of 479.66 g/mol. Its IUPAC name is (8R,9S,13S,14R,15S)-15-[(benzylamino)methyl]-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14R,15S)-15-[(benzylamino)methyl]-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 66624320 |
| Molecular Formula | C33H37NO2 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | (8R,9S,13S,14R,15S)-15-[(benzylamino)methyl]-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1[C@@H](CNCc1ccccc1)CC2=O |
| InChI | InChI=1S/C33H37NO2/c1-33-17-16-29-28-15-13-27(36-22-24-10-6-3-7-11-24)18-25(28)12-14-30(29)32(33)26(19-31(33)35)21-34-20-23-8-4-2-5-9-23/h2-11,13,15,18,26,29-30,32,34H,12,14,16-17,19-22H2,1H3/t26-,29-,30-,32+,33-/m1/s1 |
| InChIKey | CXPXQMDOTSKFCL-BBMMXVJJSA-N |
| XLogP | 6.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |