C30H34O2 — CID 87668825
(8R,9S,13S,14S)-13-methyl-15-pent-4-ynyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 87668825) has the molecular formula C30H34O2 and a molecular weight of 426.60 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-15-pent-4-ynyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-15-pent-4-ynyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 87668825 |
| Molecular Formula | C30H34O2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-15-pent-4-ynyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C#CCCCC1CC(=O)[C@@]2(C)CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C30H34O2/c1-3-4-6-11-23-19-28(31)30(2)17-16-26-25-15-13-24(32-20-21-9-7-5-8-10-21)18-22(25)12-14-27(26)29(23)30/h1,5,7-10,13,15,18,23,26-27,29H,4,6,11-12,14,16-17,19-20H2,2H3/t23?,26-,27-,29+,30-/m1/s1 |
| InChIKey | NWMWTTGIIUTWBT-JEKYXUDUSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|