C25H30O4 — CID 177290867
(13S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16,17-triol (PubChem CID 177290867) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (13S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16,17-triol.
| Compound Name | (13S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16,17-triol |
|---|---|
| PubChem CID | 177290867 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (13S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16,17-triol |
| SMILES | C[C@]12CCC3c4ccc(OCc5ccccc5)cc4CCC3C1C(O)C(O)[C@@H]2O |
| InChI | InChI=1S/C25H30O4/c1-25-12-11-19-18-10-8-17(29-14-15-5-3-2-4-6-15)13-16(18)7-9-20(19)21(25)22(26)23(27)24(25)28/h2-6,8,10,13,19-24,26-28H,7,9,11-12,14H2,1H3/t19?,20?,21?,22?,23?,24-,25-/m0/s1 |
| InChIKey | NLYGQTXAMALBBN-BLIQZVMBSA-N |
| XLogP | 3.42 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |