C33H46O6 — CID 90808021
(8R,9S,13S,14S)-16-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 90808021) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is (8R,9S,13S,14S)-16-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S)-16-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 90808021 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | (8R,9S,13S,14S)-16-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CC(CCOCCOCCOCCO)C2O |
| InChI | InChI=1S/C33H46O6/c1-33-13-11-29-28-10-8-27(39-23-24-5-3-2-4-6-24)21-25(28)7-9-30(29)31(33)22-26(32(33)35)12-15-36-17-19-38-20-18-37-16-14-34/h2-6,8,10,21,26,29-32,34-35H,7,9,11-20,22-23H2,1H3/t26?,29-,30-,31+,32?,33+/m1/s1 |
| InChIKey | YJEMWPOILZLBQD-OIAGRQHKSA-N |
| XLogP | 5.14 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|