C32H38O4 — CID 20833555
(8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;phenylmethoxymethylbenzene (PubChem CID 20833555) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;phenylmethoxymethylbenzene.
| Compound Name | (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;phenylmethoxymethylbenzene |
|---|---|
| PubChem CID | 20833555 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;phenylmethoxymethylbenzene |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C[C@@H](O)[C@@H]2O.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H24O3.C14H14O/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21;1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3;1-10H,11-12H2/t13-,14-,15+,16-,17+,18+;/m1./s1 |
| InChIKey | PSSNDPBHMNTPJR-OBXBXFETSA-N |
| XLogP | 5.98 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |