C33H35N3O2 — CID 122222087
(8R,9S,13R,14S,16R,17S)-13-methyl-3-phenylmethoxy-16-(4-phenyltriazol-1-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 122222087) has the molecular formula C33H35N3O2 and a molecular weight of 505.66 g/mol. Its IUPAC name is (8R,9S,13R,14S,16R,17S)-13-methyl-3-phenylmethoxy-16-(4-phenyltriazol-1-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13R,14S,16R,17S)-13-methyl-3-phenylmethoxy-16-(4-phenyltriazol-1-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 122222087 |
| Molecular Formula | C33H35N3O2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (8R,9S,13R,14S,16R,17S)-13-methyl-3-phenylmethoxy-16-(4-phenyltriazol-1-yl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1C[C@@H](n1cc(-c3ccccc3)nn1)[C@H]2O |
| InChI | InChI=1S/C33H35N3O2/c1-33-17-16-27-26-15-13-25(38-21-22-8-4-2-5-9-22)18-24(26)12-14-28(27)29(33)19-31(32(33)37)36-20-30(34-35-36)23-10-6-3-7-11-23/h2-11,13,15,18,20,27-29,31-32,37H,12,14,16-17,19,21H2,1H3/t27-,28-,29+,31-,32-,33-/m1/s1 |
| InChIKey | DYNGWIORNSJJCN-NJMKYPMXSA-N |
| XLogP | 6.59 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |