C30H36O4 — CID 70117958
[(8R,9S,13S,14S,16E,17R)-16-(ethoxymethylidene)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70117958) has the molecular formula C30H36O4 and a molecular weight of 460.61 g/mol. Its IUPAC name is [(8R,9S,13S,14S,16E,17R)-16-(ethoxymethylidene)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,16E,17R)-16-(ethoxymethylidene)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70117958 |
| Molecular Formula | C30H36O4 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | [(8R,9S,13S,14S,16E,17R)-16-(ethoxymethylidene)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CCO/C=C1\C[C@H]2[C@@H]3CCc4cc(OCc5ccccc5)ccc4[C@H]3CC[C@]2(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H36O4/c1-4-32-19-23-17-28-27-12-10-22-16-24(33-18-21-8-6-5-7-9-21)11-13-25(22)26(27)14-15-30(28,3)29(23)34-20(2)31/h5-9,11,13,16,19,26-29H,4,10,12,14-15,17-18H2,1-3H3/b23-19+/t26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | HMCLHVVUXKOORB-OVVFVCBESA-N |
| XLogP | 6.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|