C18H22O3S — CID 18641938
(13R)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-sulfonic acid (PubChem CID 18641938) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is (13R)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-sulfonic acid.
| Compound Name | (13R)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-sulfonic acid |
|---|---|
| PubChem CID | 18641938 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (13R)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-sulfonic acid |
| SMILES | C[C@@]12C=CCC1C1CCc3cc(S(=O)(=O)O)ccc3C1CC2 |
| InChI | InChI=1S/C18H22O3S/c1-18-9-2-3-17(18)16-6-4-12-11-13(22(19,20)21)5-7-14(12)15(16)8-10-18/h2,5,7,9,11,15-17H,3-4,6,8,10H2,1H3,(H,19,20,21)/t15?,16?,17?,18-/m0/s1 |
| InChIKey | WYYWVRZQRRKUPN-HLYMMOCJSA-N |
| XLogP | 3.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|