C18H22 — CID 22596813
13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene (PubChem CID 22596813) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene.
| Compound Name | 13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22596813 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene |
| SMILES | CC12C=CCC1C1CCc3ccccc3C1CC2 |
| InChI | InChI=1S/C18H22/c1-18-11-4-7-17(18)16-9-8-13-5-2-3-6-14(13)15(16)10-12-18/h2-6,11,15-17H,7-10,12H2,1H3 |
| InChIKey | PYIJEJMRNVKOAJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|