C28H32O2 — CID 11143846
(8R,9S,13S,14S,17S)-13-methyl-3-phenylmethoxy-17-prop-2-enyl-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 11143846) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-13-methyl-3-phenylmethoxy-17-prop-2-enyl-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-13-methyl-3-phenylmethoxy-17-prop-2-enyl-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 11143846 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-3-phenylmethoxy-17-prop-2-enyl-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C=CC[C@]1(O)C=C[C@H]2[C@@H]3CCc4cc(OCc5ccccc5)ccc4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H32O2/c1-3-15-28(29)17-14-26-25-11-9-21-18-22(30-19-20-7-5-4-6-8-20)10-12-23(21)24(25)13-16-27(26,28)2/h3-8,10,12,14,17-18,24-26,29H,1,9,11,13,15-16,19H2,2H3/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | HYICSULWQQUDBC-MASCHLQQSA-N |
| XLogP | 6.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|