C27H40O2Si — CID 11281713
(2S)-2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]propanal (PubChem CID 11281713) has the molecular formula C27H40O2Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (2S)-2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]propanal.
| Compound Name | (2S)-2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]propanal |
|---|---|
| PubChem CID | 11281713 |
| Molecular Formula | C27H40O2Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (2S)-2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]propanal |
| SMILES | C[C@H](C=O)C1=CC[C@H]2[C@@H]3CCc4cc(O[Si](C)(C)C(C)(C)C)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H40O2Si/c1-18(17-28)24-12-13-25-23-10-8-19-16-20(29-30(6,7)26(2,3)4)9-11-21(19)22(23)14-15-27(24,25)5/h9,11-12,16-18,22-23,25H,8,10,13-15H2,1-7H3/t18-,22-,23-,25+,27-/m1/s1 |
| InChIKey | GNLKWPQCJDYGLG-MPMXGWRYSA-N |
| XLogP | 7.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|