C33H43NO2Si — CID 44512288
(8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-isoquinolin-7-yl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 44512288) has the molecular formula C33H43NO2Si and a molecular weight of 513.80 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-isoquinolin-7-yl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-isoquinolin-7-yl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 44512288 |
| Molecular Formula | C33H43NO2Si |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-isoquinolin-7-yl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)c1ccc2ccncc2c1 |
| InChI | InChI=1S/C33H43NO2Si/c1-31(2,3)37(5,6)36-26-10-12-27-23(20-26)8-11-29-28(27)13-16-32(4)30(29)14-17-33(32,35)25-9-7-22-15-18-34-21-24(22)19-25/h7,9-10,12,15,18-21,28-30,35H,8,11,13-14,16-17H2,1-6H3/t28-,29-,30+,32+,33-/m1/s1 |
| InChIKey | YJRLYOUWDJENNK-UWTCGJGWSA-N |
| XLogP | 8.36 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|