C31H42O2Si — CID 101218446
(8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-(2-cyclopenta-1,3-dien-1-ylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 101218446) has the molecular formula C31H42O2Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-(2-cyclopenta-1,3-dien-1-ylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-(2-cyclopenta-1,3-dien-1-ylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 101218446 |
| Molecular Formula | C31H42O2Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-17-(2-cyclopenta-1,3-dien-1-ylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C#CC1=CC=CC1 |
| InChI | InChI=1S/C31H42O2Si/c1-29(2,3)34(5,6)33-24-12-14-25-23(21-24)11-13-27-26(25)16-18-30(4)28(27)17-20-31(30,32)19-15-22-9-7-8-10-22/h7-9,12,14,21,26-28,32H,10-11,13,16-18,20H2,1-6H3/t26-,27-,28+,30+,31+/m1/s1 |
| InChIKey | KLPFYHZEGLBFLM-WVZXCZDFSA-N |
| XLogP | 7.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|