C44H48O6 — CID 91348249
bis[(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] but-2-enedioate (PubChem CID 91348249) has the molecular formula C44H48O6 and a molecular weight of 672.86 g/mol. Its IUPAC name is bis[(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] but-2-enedioate.
| Compound Name | bis[(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] but-2-enedioate |
|---|---|
| PubChem CID | 91348249 |
| Molecular Formula | C44H48O6 |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | bis[(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] but-2-enedioate |
| SMILES | C#C[C@]1(O)CCC2C3CCc4cc(OC(=O)C=CC(=O)Oc5ccc6c(c5)CCC5C6CC[C@@]6(C)C5CC[C@@]6(O)C#C)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C44H48O6/c1-5-43(47)23-19-37-35-11-7-27-25-29(9-13-31(27)33(35)17-21-41(37,43)3)49-39(45)15-16-40(46)50-30-10-14-32-28(26-30)8-12-36-34(32)18-22-42(4)38(36)20-24-44(42,48)6-2/h1-2,9-10,13-16,25-26,33-38,47-48H,7-8,11-12,17-24H2,3-4H3/t33?,34?,35?,36?,37?,38?,41-,42-,43-,44-/m0/s1 |
| InChIKey | JPUIRJPRCVHIOH-OWDZIZFFSA-N |
| XLogP | 7.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|