C23H29NO4 — CID 87285663
[(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-hydroxypropanoate (PubChem CID 87285663) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is [(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-hydroxypropanoate.
| Compound Name | [(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-hydroxypropanoate |
|---|---|
| PubChem CID | 87285663 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [(13S,17R)-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-hydroxypropanoate |
| SMILES | C#C[C@]1(O)CCC2C3CCc4cc(OC(=O)[C@@H](N)CO)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C23H29NO4/c1-3-23(27)11-9-19-18-6-4-14-12-15(28-21(26)20(24)13-25)5-7-16(14)17(18)8-10-22(19,23)2/h1,5,7,12,17-20,25,27H,4,6,8-11,13,24H2,2H3/t17?,18?,19?,20-,22-,23-/m0/s1 |
| InChIKey | CGFMLCOYQYRPCM-GHHLVXKOSA-N |
| XLogP | 2.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|