C28H38NO3 — CID 100937382
CID 100937382 (PubChem CID 100937382) has the molecular formula C28H38NO3 and a molecular weight of 436.62 g/mol.
| Compound Name | CID 100937382 |
|---|---|
| PubChem CID | 100937382 |
| Molecular Formula | C28H38NO3 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C#CC1(C)CCC(C)(C)N1[O] |
| InChI | InChI=1S/C28H38NO3/c1-25(2)14-15-26(3,29(25)31)16-17-28(30)13-11-24-23-8-6-19-18-20(32-5)7-9-21(19)22(23)10-12-27(24,28)4/h7,9,18,22-24,30H,6,8,10-15H2,1-5H3/t22-,23-,24+,26?,27+,28-/m1/s1 |
| InChIKey | MWAIHOZGEFIFMF-YTIMDGDXSA-N |
| XLogP | 5.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|