C36H46FeO2Si+2 — CID 10371264
CID 10371264 (PubChem CID 10371264) has the molecular formula C36H46FeO2Si+2 and a molecular weight of 594.69 g/mol.
| Compound Name | CID 10371264 |
|---|---|
| PubChem CID | 10371264 |
| Molecular Formula | C36H46FeO2Si+2 |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC2(O)C#C[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C31H41O2Si.C5H5.Fe/c1-29(2,3)34(5,6)33-24-12-14-25-23(21-24)11-13-27-26(25)16-18-30(4)28(27)17-20-31(30,32)19-15-22-9-7-8-10-22;1-2-4-5-3-1;/h7-10,12,14,21,26-28,32H,11,13,16-18,20H2,1-6H3;1-5H;/q;;+2/t26-,27-,28+,30+,31?;;/m1../s1 |
| InChIKey | MEUVMICUCKLWNB-KJEQHJMCSA-N |
| XLogP | 8.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|