C28H41N3O2Si — CID 58622018
3-[(9S)-16-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,13(18),14,16-tetraen-7-yl]propanenitrile (PubChem CID 58622018) has the molecular formula C28H41N3O2Si and a molecular weight of 479.74 g/mol. Its IUPAC name is 3-[(9S)-16-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,13(18),14,16-tetraen-7-yl]propanenitrile.
| Compound Name | 3-[(9S)-16-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,13(18),14,16-tetraen-7-yl]propanenitrile |
|---|---|
| PubChem CID | 58622018 |
| Molecular Formula | C28H41N3O2Si |
| Molecular Weight | 479.74 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | 3-[(9S)-16-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,13(18),14,16-tetraen-7-yl]propanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CC1C=NN(CCC#N)C12O |
| InChI | InChI=1S/C28H41N3O2Si/c1-26(2,3)34(5,6)33-21-9-11-22-19(16-21)8-10-24-23(22)12-13-27(4)25(24)17-20-18-30-31(15-7-14-29)28(20,27)32/h9,11,16,18,20,23-25,32H,7-8,10,12-13,15,17H2,1-6H3/t20?,23?,24?,25?,27-,28?/m0/s1 |
| InChIKey | YLABKBWYCUQQJC-UMTPFVDQSA-N |
| XLogP | 6.06 |
| TPSA | 68.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.74 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|