C28H42O3Si — CID 18346599
ethyl (2Z)-2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetate (PubChem CID 18346599) has the molecular formula C28H42O3Si and a molecular weight of 454.73 g/mol. Its IUPAC name is ethyl (2Z)-2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetate |
|---|---|
| PubChem CID | 18346599 |
| Molecular Formula | C28H42O3Si |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | ethyl (2Z)-2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/CCC2C3CCc4cc(O[Si](C)(C)C(C)(C)C)ccc4C3CCC12C |
| InChI | InChI=1S/C28H42O3Si/c1-8-30-26(29)18-20-10-14-25-24-12-9-19-17-21(31-32(6,7)27(2,3)4)11-13-22(19)23(24)15-16-28(20,25)5/h11,13,17-18,23-25H,8-10,12,14-16H2,1-7H3/b20-18- |
| InChIKey | FNKWUVFDINQFAZ-ZZEZOPTASA-N |
| XLogP | 7.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|