C23H27NO5S — CID 52918378
ethyl (2E)-2-[(2S,5S,9S,10S)-5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),13,15(20),18-tetraen-6-ylidene]acetate (PubChem CID 52918378) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is ethyl (2E)-2-[(2S,5S,9S,10S)-5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),13,15(20),18-tetraen-6-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(2S,5S,9S,10S)-5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),13,15(20),18-tetraen-6-ylidene]acetate |
|---|---|
| PubChem CID | 52918378 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl (2E)-2-[(2S,5S,9S,10S)-5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),13,15(20),18-tetraen-6-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CC[C@H]2[C@@H]3CCc4cc5c(cc4[C@H]3CC[C@]12C)C=NS(=O)(=O)O5 |
| InChI | InChI=1S/C23H27NO5S/c1-3-28-22(25)12-16-5-7-20-18-6-4-14-11-21-15(13-24-30(26,27)29-21)10-19(14)17(18)8-9-23(16,20)2/h10-13,17-18,20H,3-9H2,1-2H3/b16-12+/t17-,18+,20-,23+/m0/s1 |
| InChIKey | AKOUAESWGPPNMB-LEPGTICASA-N |
| XLogP | 4.09 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|