C25H30N2O4S — CID 163929914
(5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),6,13,15(20),18-pentaen-6-yl)-(3-propylaziridin-2-yl)methanone (PubChem CID 163929914) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is (5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),6,13,15(20),18-pentaen-6-yl)-(3-propylaziridin-2-yl)methanone.
| Compound Name | (5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),6,13,15(20),18-pentaen-6-yl)-(3-propylaziridin-2-yl)methanone |
|---|---|
| PubChem CID | 163929914 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (5-methyl-17,17-dioxo-16-oxa-17λ6-thia-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),6,13,15(20),18-pentaen-6-yl)-(3-propylaziridin-2-yl)methanone |
| SMILES | CCCC1NC1C(=O)C1=CCC2C3CCc4cc5c(cc4C3CCC12C)C=NS(=O)(=O)O5 |
| InChI | InChI=1S/C25H30N2O4S/c1-3-4-21-23(27-21)24(28)20-8-7-19-17-6-5-14-12-22-15(13-26-32(29,30)31-22)11-18(14)16(17)9-10-25(19,20)2/h8,11-13,16-17,19,21,23,27H,3-7,9-10H2,1-2H3 |
| InChIKey | ROEDGXQHWCBYPU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|