C28H33FN2O2 — CID 130405344
4-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoic acid (PubChem CID 130405344) has the molecular formula C28H33FN2O2 and a molecular weight of 448.58 g/mol. Its IUPAC name is 4-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoic acid.
| Compound Name | 4-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 130405344 |
| Molecular Formula | C28H33FN2O2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 4-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)c1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cncc(F)c3)=CC[C@@H]12 |
| InChI | InChI=1S/C28H33FN2O2/c1-28-12-11-23-22-8-6-21(31(2)13-3-4-27(32)33)15-18(22)5-7-24(23)26(28)10-9-25(28)19-14-20(29)17-30-16-19/h6,8-9,14-17,23-24,26H,3-5,7,10-13H2,1-2H3,(H,32,33)/t23-,24-,26+,28-/m1/s1 |
| InChIKey | GNSLCZRDPBRMEI-WXGXSRQYSA-N |
| XLogP | 6.07 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|