C29H35FN2O2 — CID 134377791
17-(5-fluoro-3-pyridinyl)-N-(3-hydroxy-2,2-dimethylpropyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 134377791) has the molecular formula C29H35FN2O2 and a molecular weight of 462.61 g/mol. Its IUPAC name is 17-(5-fluoro-3-pyridinyl)-N-(3-hydroxy-2,2-dimethylpropyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | 17-(5-fluoro-3-pyridinyl)-N-(3-hydroxy-2,2-dimethylpropyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 134377791 |
| Molecular Formula | C29H35FN2O2 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 17-(5-fluoro-3-pyridinyl)-N-(3-hydroxy-2,2-dimethylpropyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | CC(C)(CO)CNC(=O)c1ccc2c(c1)CCC1C2CCC2(C)C(c3cncc(F)c3)=CCC12 |
| InChI | InChI=1S/C29H35FN2O2/c1-28(2,17-33)16-32-27(34)19-5-6-22-18(12-19)4-7-24-23(22)10-11-29(3)25(8-9-26(24)29)20-13-21(30)15-31-14-20/h5-6,8,12-15,23-24,26,33H,4,7,9-11,16-17H2,1-3H3,(H,32,34) |
| InChIKey | UWSNJJGCVMJPQT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |