C27H29FN6O — CID 134377401
17-(5-fluoro-3-pyridinyl)-13-methyl-N-[2-(2H-tetrazol-5-yl)ethyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 134377401) has the molecular formula C27H29FN6O and a molecular weight of 472.57 g/mol. Its IUPAC name is 17-(5-fluoro-3-pyridinyl)-13-methyl-N-[2-(2H-tetrazol-5-yl)ethyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | 17-(5-fluoro-3-pyridinyl)-13-methyl-N-[2-(2H-tetrazol-5-yl)ethyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 134377401 |
| Molecular Formula | C27H29FN6O |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 17-(5-fluoro-3-pyridinyl)-13-methyl-N-[2-(2H-tetrazol-5-yl)ethyl]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | CC12CCC3c4ccc(C(=O)NCCc5nn[nH]n5)cc4CCC3C1CC=C2c1cncc(F)c1 |
| InChI | InChI=1S/C27H29FN6O/c1-27-10-8-21-20-4-3-17(26(35)30-11-9-25-31-33-34-32-25)12-16(20)2-5-22(21)24(27)7-6-23(27)18-13-19(28)15-29-14-18/h3-4,6,12-15,21-22,24H,2,5,7-11H2,1H3,(H,30,35)(H,31,32,33,34) |
| InChIKey | TYRFBNZVTCWRRC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |