C23H25FN2 — CID 118951169
(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-amine (PubChem CID 118951169) has the molecular formula C23H25FN2 and a molecular weight of 348.46 g/mol. Its IUPAC name is (8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-amine.
| Compound Name | (8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 118951169 |
| Molecular Formula | C23H25FN2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-amine |
| SMILES | C[C@]12CC[C@@H]3c4ccc(N)cc4CC[C@H]3[C@@H]1CC=C2c1cncc(F)c1 |
| InChI | InChI=1S/C23H25FN2/c1-23-9-8-19-18-5-3-17(25)11-14(18)2-4-20(19)22(23)7-6-21(23)15-10-16(24)13-26-12-15/h3,5-6,10-13,19-20,22H,2,4,7-9,25H2,1H3/t19-,20-,22+,23-/m1/s1 |
| InChIKey | VZPTZNZGMZWKRV-YXPKMTABSA-N |
| XLogP | 5.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|