C29H35FN2O2 — CID 118951239
methyl 4-[[(13S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoate (PubChem CID 118951239) has the molecular formula C29H35FN2O2 and a molecular weight of 462.61 g/mol. Its IUPAC name is methyl 4-[[(13S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoate.
| Compound Name | methyl 4-[[(13S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoate |
|---|---|
| PubChem CID | 118951239 |
| Molecular Formula | C29H35FN2O2 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | methyl 4-[[(13S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)c1ccc2c(c1)CCC1C2CC[C@]2(C)C(c3cncc(F)c3)=CCC12 |
| InChI | InChI=1S/C29H35FN2O2/c1-29-13-12-24-23-9-7-22(32(2)14-4-5-28(33)34-3)16-19(23)6-8-25(24)27(29)11-10-26(29)20-15-21(30)18-31-17-20/h7,9-10,15-18,24-25,27H,4-6,8,11-14H2,1-3H3/t24?,25?,27?,29-/m1/s1 |
| InChIKey | ACWAYGVMGHGYKM-LCLUTDESSA-N |
| XLogP | 6.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|