C30H43NO6S2Si — CID 16718764
[(8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzenesulfonate (PubChem CID 16718764) has the molecular formula C30H43NO6S2Si and a molecular weight of 605.90 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzenesulfonate.
| Compound Name | [(8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 16718764 |
| Molecular Formula | C30H43NO6S2Si |
| Molecular Weight | 605.90 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzenesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OS(=O)(=O)c3cccc(S(N)(=O)=O)c3)CC[C@@H]12 |
| InChI | InChI=1S/C30H43NO6S2Si/c1-29(2,3)40(5,6)37-21-11-13-24-20(18-21)10-12-26-25(24)16-17-30(4)27(26)14-15-28(30)36-39(34,35)23-9-7-8-22(19-23)38(31,32)33/h7-9,11,13,18-19,25-28H,10,12,14-17H2,1-6H3,(H2,31,32,33)/t25-,26-,27+,28+,30+/m1/s1 |
| InChIKey | BIMUHNQIWIDNED-BOJCFLQHSA-N |
| XLogP | 6.35 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.90 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|