C30H44N2O5SSi — CID 69331986
[(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-methyl-5-sulfamoylpyrrole-2-carboxylate (PubChem CID 69331986) has the molecular formula C30H44N2O5SSi and a molecular weight of 572.84 g/mol. Its IUPAC name is [(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-methyl-5-sulfamoylpyrrole-2-carboxylate.
| Compound Name | [(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-methyl-5-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 69331986 |
| Molecular Formula | C30H44N2O5SSi |
| Molecular Weight | 572.84 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | [(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-methyl-5-sulfamoylpyrrole-2-carboxylate |
| SMILES | Cn1c(C(=O)O[C@H]2CCC3C4CCc5cc(O[Si](C)(C)C(C)(C)C)ccc5C4CC[C@@]32C)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C30H44N2O5SSi/c1-29(2,3)39(6,7)37-20-9-11-21-19(18-20)8-10-23-22(21)16-17-30(4)24(23)12-14-26(30)36-28(33)25-13-15-27(32(25)5)38(31,34)35/h9,11,13,15,18,22-24,26H,8,10,12,14,16-17H2,1-7H3,(H2,31,34,35)/t22?,23?,24?,26-,30-/m0/s1 |
| InChIKey | LIKKAQDBTSZICN-AQXXYXHQSA-N |
| XLogP | 6.14 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.84 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|