C25H28ClNO5S — CID 68819295
[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 68819295) has the molecular formula C25H28ClNO5S and a molecular weight of 490.02 g/mol. Its IUPAC name is [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 68819295 |
| Molecular Formula | C25H28ClNO5S |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC[C@@H]2OC(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C25H28ClNO5S/c1-25-11-10-18-17-6-3-15(28)12-14(17)2-5-19(18)21(25)7-9-23(25)32-24(29)20-13-16(33(27,30)31)4-8-22(20)26/h3-4,6,8,12-13,18-19,21,23,28H,2,5,7,9-11H2,1H3,(H2,27,30,31)/t18?,19?,21?,23-,25-/m0/s1 |
| InChIKey | UADWEQFJAUHLHU-AHKFYQPUSA-N |
| XLogP | 4.77 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |