C27H32ClNO6S — CID 68821710
[(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 68821710) has the molecular formula C27H32ClNO6S and a molecular weight of 534.07 g/mol. Its IUPAC name is [(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 68821710 |
| Molecular Formula | C27H32ClNO6S |
| Molecular Weight | 534.07 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | [(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | CCOc1cc2c(cc1O)CCC1C2CC[C@@]2(C)C1CC[C@@H]2OC(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C27H32ClNO6S/c1-3-34-24-14-19-15(12-23(24)30)4-6-18-17(19)10-11-27(2)21(18)7-9-25(27)35-26(31)20-13-16(36(29,32)33)5-8-22(20)28/h5,8,12-14,17-18,21,25,30H,3-4,6-7,9-11H2,1-2H3,(H2,29,32,33)/t17?,18?,21?,25-,27-/m0/s1 |
| InChIKey | YNKLJFALQFCGGP-DLOWVTGWSA-N |
| XLogP | 5.17 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.07 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |