C29H37NO8S — CID 68821810
[(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate (PubChem CID 68821810) has the molecular formula C29H37NO8S and a molecular weight of 559.68 g/mol. Its IUPAC name is [(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate.
| Compound Name | [(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 68821810 |
| Molecular Formula | C29H37NO8S |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | [(13S,17S)-2-ethoxy-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate |
| SMILES | CCOc1cc2c(cc1O)CCC1C2CC[C@@]2(C)C1CC[C@@H]2OC(=O)c1cc(S(N)(=O)=O)cc(OC)c1OC |
| InChI | InChI=1S/C29H37NO8S/c1-5-37-24-15-20-16(12-23(24)31)6-7-19-18(20)10-11-29(2)22(19)8-9-26(29)38-28(32)21-13-17(39(30,33)34)14-25(35-3)27(21)36-4/h12-15,18-19,22,26,31H,5-11H2,1-4H3,(H2,30,33,34)/t18?,19?,22?,26-,29-/m0/s1 |
| InChIKey | OWQWZXOKVNBPFT-OFQPJVFXSA-N |
| XLogP | 4.54 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |