C27H35NO7S — CID 11670814
[(13S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate (PubChem CID 11670814) has the molecular formula C27H35NO7S and a molecular weight of 517.64 g/mol. Its IUPAC name is [(13S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate.
| Compound Name | [(13S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 11670814 |
| Molecular Formula | C27H35NO7S |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | [(13S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3-dimethoxy-5-sulfamoylbenzoate |
| SMILES | COc1cc(S(N)(=O)=O)cc(C(=O)O[C@H]2CCC3C4CCC5=CC(=O)CCC5C4CC[C@@]32C)c1OC |
| InChI | InChI=1S/C27H35NO7S/c1-27-11-10-19-18-7-5-16(29)12-15(18)4-6-20(19)22(27)8-9-24(27)35-26(30)21-13-17(36(28,31)32)14-23(33-2)25(21)34-3/h12-14,18-20,22,24H,4-11H2,1-3H3,(H2,28,31,32)/t18?,19?,20?,22?,24-,27-/m0/s1 |
| InChIKey | NWULVCJRTHAJNL-XIDUTXORSA-N |
| XLogP | 4.02 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |