C27H35NO6S — CID 11555136
[(7R,13S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 11555136) has the molecular formula C27H35NO6S and a molecular weight of 501.65 g/mol. Its IUPAC name is [(7R,13S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [(7R,13S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 11555136 |
| Molecular Formula | C27H35NO6S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | [(7R,13S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)O[C@H]1CCC2C3C(C)CC4=CC(=O)CCC4C3CC[C@@]21C |
| InChI | InChI=1S/C27H35NO6S/c1-15-12-16-13-17(29)4-6-19(16)20-10-11-27(2)22(25(15)20)7-9-24(27)34-26(30)21-14-18(35(28,31)32)5-8-23(21)33-3/h5,8,13-15,19-20,22,24-25H,4,6-7,9-12H2,1-3H3,(H2,28,31,32)/t15?,19?,20?,22?,24-,25?,27-/m0/s1 |
| InChIKey | RZUPIYBVJCXWCD-FZQKVJJSSA-N |
| XLogP | 4.26 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |