C47H68O6 — CID 168849709
bis(7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) heptanedioate (PubChem CID 168849709) has the molecular formula C47H68O6 and a molecular weight of 729.05 g/mol. Its IUPAC name is bis(7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) heptanedioate.
| Compound Name | bis(7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) heptanedioate |
|---|---|
| PubChem CID | 168849709 |
| Molecular Formula | C47H68O6 |
| Molecular Weight | 729.05 g/mol |
| Exact Mass | 728.50 |
| IUPAC Name | bis(7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) heptanedioate |
| SMILES | CC1CC2(C)C(OC(=O)CCCCCC(=O)OC3CCC4C5C(C)CC6=CC(=O)CCC6C5C(C)CC34C)CCC2C2C(C)CC3=CC(=O)CCC3C12 |
| InChI | InChI=1S/C47H68O6/c1-26-20-30-22-32(48)12-14-34(30)42-28(3)24-46(5)36(44(26)42)16-18-38(46)52-40(50)10-8-7-9-11-41(51)53-39-19-17-37-45-27(2)21-31-23-33(49)13-15-35(31)43(45)29(4)25-47(37,39)6/h22-23,26-29,34-39,42-45H,7-21,24-25H2,1-6H3 |
| InChIKey | BDWYWRNTOIEPDF-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.05 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|