C23H35NO3 — CID 166888128
(7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) N,N-dimethylcarbamate (PubChem CID 166888128) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is (7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) N,N-dimethylcarbamate.
| Compound Name | (7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 166888128 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | (7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) N,N-dimethylcarbamate |
| SMILES | CC1CC2(C)C(OC(=O)N(C)C)CCC2C2C(C)CC3=CC(=O)CCC3C12 |
| InChI | InChI=1S/C23H35NO3/c1-13-10-15-11-16(25)6-7-17(15)20-14(2)12-23(3)18(21(13)20)8-9-19(23)27-22(26)24(4)5/h11,13-14,17-21H,6-10,12H2,1-5H3 |
| InChIKey | NODPNAQZLUQFHT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |