C26H33NO5S — CID 11619779
[(7R,8R,9S,10R,13S,14S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate (PubChem CID 11619779) has the molecular formula C26H33NO5S and a molecular weight of 471.62 g/mol. Its IUPAC name is [(7R,8R,9S,10R,13S,14S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate.
| Compound Name | [(7R,8R,9S,10R,13S,14S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 11619779 |
| Molecular Formula | C26H33NO5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | [(7R,8R,9S,10R,13S,14S,17S)-7,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate |
| SMILES | C[C@@H]1CC2=CC(=O)CC[C@@H]2[C@H]2CC[C@]3(C)[C@@H](OC(=O)c4cccc(S(N)(=O)=O)c4)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C26H33NO5S/c1-15-12-17-13-18(28)6-7-20(17)21-10-11-26(2)22(24(15)21)8-9-23(26)32-25(29)16-4-3-5-19(14-16)33(27,30)31/h3-5,13-15,20-24H,6-12H2,1-2H3,(H2,27,30,31)/t15-,20+,21-,22+,23+,24-,26+/m1/s1 |
| InChIKey | WJMMQGPLJIJKLU-ILTBDXCGSA-N |
| XLogP | 4.25 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |