C26H31Cl2NO5S — CID 11548370
[(6S,10R,13S,17S)-6,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,4-dichloro-5-sulfamoylbenzoate (PubChem CID 11548370) has the molecular formula C26H31Cl2NO5S and a molecular weight of 540.51 g/mol. Its IUPAC name is [(6S,10R,13S,17S)-6,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,4-dichloro-5-sulfamoylbenzoate.
| Compound Name | [(6S,10R,13S,17S)-6,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,4-dichloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 11548370 |
| Molecular Formula | C26H31Cl2NO5S |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [(6S,10R,13S,17S)-6,13-dimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,4-dichloro-5-sulfamoylbenzoate |
| SMILES | C[C@H]1CC2C(CC[C@@]3(C)C2CC[C@@H]3OC(=O)c2cc(S(N)(=O)=O)c(Cl)cc2Cl)[C@H]2CCC(=O)C=C12 |
| InChI | InChI=1S/C26H31Cl2NO5S/c1-13-9-18-16(15-4-3-14(30)10-17(13)15)7-8-26(2)20(18)5-6-24(26)34-25(31)19-11-23(35(29,32)33)22(28)12-21(19)27/h10-13,15-16,18,20,24H,3-9H2,1-2H3,(H2,29,32,33)/t13-,15+,16?,18?,20?,24-,26-/m0/s1 |
| InChIKey | GFXPCGQYHNRYBI-FVPQJZPASA-N |
| XLogP | 5.55 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |