C20H27FO3 — CID 57039635
(6S,8R,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57039635) has the molecular formula C20H27FO3 and a molecular weight of 334.43 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8R,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57039635 |
| Molecular Formula | C20H27FO3 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](C[C@H](F)C4=CC(=O)CC[C@@H]43)[C@@H]1CC[C@@H]2C(=O)CO |
| InChI | InChI=1S/C20H27FO3/c1-20-7-6-13-12-3-2-11(23)8-15(12)18(21)9-14(13)16(20)4-5-17(20)19(24)10-22/h8,12-14,16-18,22H,2-7,9-10H2,1H3/t12-,13-,14-,16+,17-,18+,20+/m1/s1 |
| InChIKey | KCGDCPJWOIFQML-UQUMSZLASA-N |
| XLogP | 3.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |