C20H30O — CID 58687196
(13R,17S)-6,13,17-trimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 58687196) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (13R,17S)-6,13,17-trimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (13R,17S)-6,13,17-trimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58687196 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (13R,17S)-6,13,17-trimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC2C(CC[C@@]3(C)C2CC[C@@H]3C)C2CCC(=O)C=C12 |
| InChI | InChI=1S/C20H30O/c1-12-10-18-16(15-6-5-14(21)11-17(12)15)8-9-20(3)13(2)4-7-19(18)20/h11-13,15-16,18-19H,4-10H2,1-3H3/t12?,13-,15?,16?,18?,19?,20+/m0/s1 |
| InChIKey | DFKOUHBZBFAZKK-LNSVXRQISA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |