C28H37NO6S — CID 11642069
[(6S,10R,13S,17S)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 11642069) has the molecular formula C28H37NO6S and a molecular weight of 515.67 g/mol. Its IUPAC name is [(6S,10R,13S,17S)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [(6S,10R,13S,17S)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 11642069 |
| Molecular Formula | C28H37NO6S |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | [(6S,10R,13S,17S)-6,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)O[C@H]1CCC2C3C[C@H](C)C4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H37NO6S/c1-16-13-19-21-6-8-25(35-26(31)20-15-18(36(29,32)33)5-7-24(20)34-4)28(21,3)12-10-22(19)27(2)11-9-17(30)14-23(16)27/h5,7,14-16,19,21-22,25H,6,8-13H2,1-4H3,(H2,29,32,33)/t16-,19?,21?,22?,25-,27+,28-/m0/s1 |
| InChIKey | RDPRYWAPCFSTNY-WMNSGMILSA-N |
| XLogP | 4.65 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |