C21H30O3 — CID 138478832
(6S,8S,9S,10R,14S,17R)-17-acetyl-17-hydroxy-6,10-dimethyl-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 138478832) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (6S,8S,9S,10R,14S,17R)-17-acetyl-17-hydroxy-6,10-dimethyl-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10R,14S,17R)-17-acetyl-17-hydroxy-6,10-dimethyl-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 138478832 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (6S,8S,9S,10R,14S,17R)-17-acetyl-17-hydroxy-6,10-dimethyl-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(O)CC[C@@H]2C1CC[C@H]1[C@H]2C[C@H](C)C2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H30O3/c1-12-10-16-15-7-9-21(24,13(2)22)18(15)5-4-17(16)20(3)8-6-14(23)11-19(12)20/h11-12,15-18,24H,4-10H2,1-3H3/t12-,15-,16-,17-,18?,20+,21-/m0/s1 |
| InChIKey | GIULDPKUZWCUQG-WKKPPTPCSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |